C26H27F3O3S — CID 10672243
2-(benzenesulfonyl)-4-benzyl-3-(3,3-dimethylbut-1-ynyl)-5,5-dimethyl-2-(trifluoromethyl)furan (PubChem CID 10672243) has the molecular formula C26H27F3O3S and a molecular weight of 476.56 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-4-benzyl-3-(3,3-dimethylbut-1-ynyl)-5,5-dimethyl-2-(trifluoromethyl)furan.
| Compound Name | 2-(benzenesulfonyl)-4-benzyl-3-(3,3-dimethylbut-1-ynyl)-5,5-dimethyl-2-(trifluoromethyl)furan |
|---|---|
| PubChem CID | 10672243 |
| Molecular Formula | C26H27F3O3S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-(benzenesulfonyl)-4-benzyl-3-(3,3-dimethylbut-1-ynyl)-5,5-dimethyl-2-(trifluoromethyl)furan |
| SMILES | CC(C)(C)C#CC1=C(Cc2ccccc2)C(C)(C)OC1(C(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27F3O3S/c1-23(2,3)17-16-21-22(18-19-12-8-6-9-13-19)24(4,5)32-25(21,26(27,28)29)33(30,31)20-14-10-7-11-15-20/h6-15H,18H2,1-5H3 |
| InChIKey | VCXWMKRVKGDQKA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|