C25H26F6O3S — CID 118220975
1-[1-(benzenesulfonyl)-3-methylidenecyclopentyl]-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene (PubChem CID 118220975) has the molecular formula C25H26F6O3S and a molecular weight of 520.54 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)-3-methylidenecyclopentyl]-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene.
| Compound Name | 1-[1-(benzenesulfonyl)-3-methylidenecyclopentyl]-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 118220975 |
| Molecular Formula | C25H26F6O3S |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 1-[1-(benzenesulfonyl)-3-methylidenecyclopentyl]-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene |
| SMILES | C=C1CCC(c2ccc(C(OCCCC)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C25H26F6O3S/c1-3-4-16-34-23(24(26,27)28,25(29,30)31)20-12-10-19(11-13-20)22(15-14-18(2)17-22)35(32,33)21-8-6-5-7-9-21/h5-13H,2-4,14-17H2,1H3 |
| InChIKey | KMQXQGPZCYFFAX-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|