C26H36O7S — CID 10672779
[(1S,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]methyl 4-methylbenzenesulfonate (PubChem CID 10672779) has the molecular formula C26H36O7S and a molecular weight of 492.63 g/mol. Its IUPAC name is [(1S,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10672779 |
| Molecular Formula | C26H36O7S |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [(1S,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]methyl 4-methylbenzenesulfonate |
| SMILES | COCCOCO[C@@H]1CC[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C26H36O7S/c1-21-8-11-24(12-9-21)34(27,28)33-19-23-10-13-26(32-20-31-17-16-29-2)25(23)14-15-30-18-22-6-4-3-5-7-22/h3-9,11-12,23,25-26H,10,13-20H2,1-2H3/t23-,25+,26-/m1/s1 |
| InChIKey | AAJUCWCTHNFMTJ-DMTNHVFBSA-N |
| XLogP | 4.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|