C15H19NSe — CID 10685032
4-hexyl-2-phenyl-1,3-selenazole (PubChem CID 10685032) has the molecular formula C15H19NSe and a molecular weight of 292.28 g/mol. Its IUPAC name is 4-hexyl-2-phenyl-1,3-selenazole.
| Compound Name | 4-hexyl-2-phenyl-1,3-selenazole |
|---|---|
| PubChem CID | 10685032 |
| Molecular Formula | C15H19NSe |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-hexyl-2-phenyl-1,3-selenazole |
| SMILES | CCCCCCc1c[se]c(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H19NSe/c1-2-3-4-8-11-14-12-17-15(16-14)13-9-6-5-7-10-13/h5-7,9-10,12H,2-4,8,11H2,1H3 |
| InChIKey | YYGKUNZEUFYHPV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|