C13H17FOS — CID 106881138
(2-fluoro-4,6-dimethylphenyl)-(thiolan-2-yl)methanol (PubChem CID 106881138) has the molecular formula C13H17FOS and a molecular weight of 240.34 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylphenyl)-(thiolan-2-yl)methanol.
| Compound Name | (2-fluoro-4,6-dimethylphenyl)-(thiolan-2-yl)methanol |
|---|---|
| PubChem CID | 106881138 |
| Molecular Formula | C13H17FOS |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2-fluoro-4,6-dimethylphenyl)-(thiolan-2-yl)methanol |
| SMILES | Cc1cc(C)c(C(O)C2CCCS2)c(F)c1 |
| InChI | InChI=1S/C13H17FOS/c1-8-6-9(2)12(10(14)7-8)13(15)11-4-3-5-16-11/h6-7,11,13,15H,3-5H2,1-2H3 |
| InChIKey | AEQOPUXQVJKMHN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |