C12H19IO4 — CID 10689439
[(2R,4R,5S,6R)-5-iodo-2-methyl-1,7-dioxaspiro[5.5]undecan-4-yl] acetate (PubChem CID 10689439) has the molecular formula C12H19IO4 and a molecular weight of 354.18 g/mol. Its IUPAC name is [(2R,4R,5S,6R)-5-iodo-2-methyl-1,7-dioxaspiro[5.5]undecan-4-yl] acetate.
| Compound Name | [(2R,4R,5S,6R)-5-iodo-2-methyl-1,7-dioxaspiro[5.5]undecan-4-yl] acetate |
|---|---|
| PubChem CID | 10689439 |
| Molecular Formula | C12H19IO4 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | [(2R,4R,5S,6R)-5-iodo-2-methyl-1,7-dioxaspiro[5.5]undecan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C)O[C@]2(CCCCO2)[C@H]1I |
| InChI | InChI=1S/C12H19IO4/c1-8-7-10(16-9(2)14)11(13)12(17-8)5-3-4-6-15-12/h8,10-11H,3-7H2,1-2H3/t8-,10-,11+,12-/m1/s1 |
| InChIKey | FRBNRDQNUDDTGA-KXGXSXBTSA-N |
| XLogP | 2.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|