C24H28ClNO2 — CID 10692226
(3R)-3-chloro-1-(2,4,6,7-tetramethyl-5-phenylmethoxy-1-benzofuran-3-yl)piperidine (PubChem CID 10692226) has the molecular formula C24H28ClNO2 and a molecular weight of 397.95 g/mol. Its IUPAC name is (3R)-3-chloro-1-(2,4,6,7-tetramethyl-5-phenylmethoxy-1-benzofuran-3-yl)piperidine.
| Compound Name | (3R)-3-chloro-1-(2,4,6,7-tetramethyl-5-phenylmethoxy-1-benzofuran-3-yl)piperidine |
|---|---|
| PubChem CID | 10692226 |
| Molecular Formula | C24H28ClNO2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (3R)-3-chloro-1-(2,4,6,7-tetramethyl-5-phenylmethoxy-1-benzofuran-3-yl)piperidine |
| SMILES | Cc1oc2c(C)c(C)c(OCc3ccccc3)c(C)c2c1N1CCC[C@@H](Cl)C1 |
| InChI | InChI=1S/C24H28ClNO2/c1-15-16(2)24-21(17(3)23(15)27-14-19-9-6-5-7-10-19)22(18(4)28-24)26-12-8-11-20(25)13-26/h5-7,9-10,20H,8,11-14H2,1-4H3/t20-/m1/s1 |
| InChIKey | SYBFJSJPZWIQAK-HXUWFJFHSA-N |
| XLogP | 6.45 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|