C23H30N2O5 — CID 10693120
benzyl (2S,4R)-4-hydroxy-1-[(2S)-9-methylidene-10-oxoazecane-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 10693120) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is benzyl (2S,4R)-4-hydroxy-1-[(2S)-9-methylidene-10-oxoazecane-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S,4R)-4-hydroxy-1-[(2S)-9-methylidene-10-oxoazecane-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10693120 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | benzyl (2S,4R)-4-hydroxy-1-[(2S)-9-methylidene-10-oxoazecane-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | C=C1CCCCCC[C@@H](C(=O)N2C[C@H](O)C[C@H]2C(=O)OCc2ccccc2)NC1=O |
| InChI | InChI=1S/C23H30N2O5/c1-16-9-5-2-3-8-12-19(24-21(16)27)22(28)25-14-18(26)13-20(25)23(29)30-15-17-10-6-4-7-11-17/h4,6-7,10-11,18-20,26H,1-3,5,8-9,12-15H2,(H,24,27)/t18-,19+,20+/m1/s1 |
| InChIKey | MILGFJIFLUKCJC-AABGKKOBSA-N |
| XLogP | 2.09 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|