C24H38O4Si — CID 10693355
methyl (3R,3aS,6aR)-2,2-ditert-butyl-3-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[d]oxasilole-4-carboxylate (PubChem CID 10693355) has the molecular formula C24H38O4Si and a molecular weight of 418.65 g/mol. Its IUPAC name is methyl (3R,3aS,6aR)-2,2-ditert-butyl-3-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[d]oxasilole-4-carboxylate.
| Compound Name | methyl (3R,3aS,6aR)-2,2-ditert-butyl-3-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[d]oxasilole-4-carboxylate |
|---|---|
| PubChem CID | 10693355 |
| Molecular Formula | C24H38O4Si |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | methyl (3R,3aS,6aR)-2,2-ditert-butyl-3-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[d]oxasilole-4-carboxylate |
| SMILES | COC(=O)C1CC[C@H]2O[Si](C(C)(C)C)(C(C)(C)C)[C@@H](COCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C24H38O4Si/c1-23(2,3)29(24(4,5)6)20(16-27-15-17-11-9-8-10-12-17)21-18(22(25)26-7)13-14-19(21)28-29/h8-12,18-21H,13-16H2,1-7H3/t18?,19-,20+,21+/m1/s1 |
| InChIKey | DVYQDAGLJBQEQB-IWORHSITSA-N |
| XLogP | 5.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|