C30H56OSi — CID 10695300
2-[(1S,2S,5R,8aR)-1,2,5-trimethyl-5-(4-methylpent-4-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethoxy-tri(propan-2-yl)silane (PubChem CID 10695300) has the molecular formula C30H56OSi and a molecular weight of 460.86 g/mol. Its IUPAC name is 2-[(1S,2S,5R,8aR)-1,2,5-trimethyl-5-(4-methylpent-4-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethoxy-tri(propan-2-yl)silane.
| Compound Name | 2-[(1S,2S,5R,8aR)-1,2,5-trimethyl-5-(4-methylpent-4-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10695300 |
| Molecular Formula | C30H56OSi |
| Molecular Weight | 460.86 g/mol |
| Exact Mass | 460.41 |
| IUPAC Name | 2-[(1S,2S,5R,8aR)-1,2,5-trimethyl-5-(4-methylpent-4-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethoxy-tri(propan-2-yl)silane |
| SMILES | C=C(C)CCC[C@@]1(C)CCC[C@H]2C1=CC[C@H](C)[C@]2(C)CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H56OSi/c1-22(2)14-12-18-29(10)19-13-15-28-27(29)17-16-26(9)30(28,11)20-21-31-32(23(3)4,24(5)6)25(7)8/h17,23-26,28H,1,12-16,18-21H2,2-11H3/t26-,28-,29-,30-/m0/s1 |
| InChIKey | ZOHNRYGCIFCKLS-SYKYGTKKSA-N |
| XLogP | 10.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.86 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|