C16H19Cl2N — CID 106985139
5,7-dichloro-3-(1-cyclohexylethyl)-1H-indole (PubChem CID 106985139) has the molecular formula C16H19Cl2N and a molecular weight of 296.24 g/mol. Its IUPAC name is 5,7-dichloro-3-(1-cyclohexylethyl)-1H-indole.
| Compound Name | 5,7-dichloro-3-(1-cyclohexylethyl)-1H-indole |
|---|---|
| PubChem CID | 106985139 |
| Molecular Formula | C16H19Cl2N |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5,7-dichloro-3-(1-cyclohexylethyl)-1H-indole |
| SMILES | CC(c1c[nH]c2c(Cl)cc(Cl)cc12)C1CCCCC1 |
| InChI | InChI=1S/C16H19Cl2N/c1-10(11-5-3-2-4-6-11)14-9-19-16-13(14)7-12(17)8-15(16)18/h7-11,19H,2-6H2,1H3 |
| InChIKey | GITOBMSKWKWZFU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |