C16H20O4 — CID 107005965
6-hept-6-enoxy-2,3-dihydro-1-benzofuran-2-carboxylic acid (PubChem CID 107005965) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 6-hept-6-enoxy-2,3-dihydro-1-benzofuran-2-carboxylic acid.
| Compound Name | 6-hept-6-enoxy-2,3-dihydro-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 107005965 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 6-hept-6-enoxy-2,3-dihydro-1-benzofuran-2-carboxylic acid |
| SMILES | C=CCCCCCOc1ccc2c(c1)OC(C(=O)O)C2 |
| InChI | InChI=1S/C16H20O4/c1-2-3-4-5-6-9-19-13-8-7-12-10-15(16(17)18)20-14(12)11-13/h2,7-8,11,15H,1,3-6,9-10H2,(H,17,18) |
| InChIKey | WLUMNNDZZWPWKD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|