C11H19N — CID 10702203
(2E)-2-butan-2-ylidene-4,4,5-trimethyl-3H-pyrrole (PubChem CID 10702203) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2E)-2-butan-2-ylidene-4,4,5-trimethyl-3H-pyrrole.
| Compound Name | (2E)-2-butan-2-ylidene-4,4,5-trimethyl-3H-pyrrole |
|---|---|
| PubChem CID | 10702203 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2E)-2-butan-2-ylidene-4,4,5-trimethyl-3H-pyrrole |
| SMILES | CC/C(C)=C1\CC(C)(C)C(C)=N1 |
| InChI | InChI=1S/C11H19N/c1-6-8(2)10-7-11(4,5)9(3)12-10/h6-7H2,1-5H3/b10-8+ |
| InChIKey | UDYSIJAXYSZWPX-CSKARUKUSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |