C12H18N6 — CID 107043717
4-N-[(2-methyltetrazol-5-yl)methyl]-4-N-propylbenzene-1,4-diamine (PubChem CID 107043717) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 4-N-[(2-methyltetrazol-5-yl)methyl]-4-N-propylbenzene-1,4-diamine.
| Compound Name | 4-N-[(2-methyltetrazol-5-yl)methyl]-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 107043717 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 4-N-[(2-methyltetrazol-5-yl)methyl]-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCN(Cc1nnn(C)n1)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H18N6/c1-3-8-18(9-12-14-16-17(2)15-12)11-6-4-10(13)5-7-11/h4-7H,3,8-9,13H2,1-2H3 |
| InChIKey | IUHWIVAWWUWRNX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|