About 1,4-dipropylimidazo[2,1-f]purin-5-one
1,4-dipropylimidazo[2,1-f]purin-5-one (PubChem CID 10706416) has the molecular formula C13H17N5O
and a molecular weight of 259.31 g/mol. Its IUPAC name is 1,4-dipropylimidazo[2,1-f]purin-5-one.
Molecular Properties
| Compound Name | 1,4-dipropylimidazo[2,1-f]purin-5-one |
| PubChem CID | 10706416 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1,4-dipropylimidazo[2,1-f]purin-5-one |
| SMILES | CCCn1cnc2c1c1nccn1c(=O)n2CCC |
| InChI | InChI=1S/C13H17N5O/c1-3-6-16-9-15-12-10(16)11-14-5-8-18(11)13(19)17(12)7-4-2/h5,8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | OKVRUQNCBZQIQY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,4-dipropylimidazo[2,1-f]purin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dipropylimidazo[2,1-f]purin-5-one?
The IUPAC name of 1,4-dipropylimidazo[2,1-f]purin-5-one (CID 10706416) is 1,4-dipropylimidazo[2,1-f]purin-5-one.
What is the SMILES notation for 1,4-dipropylimidazo[2,1-f]purin-5-one?
The canonical SMILES for 1,4-dipropylimidazo[2,1-f]purin-5-one is CCCn1cnc2c1c1nccn1c(=O)n2CCC.
What is the InChIKey of 1,4-dipropylimidazo[2,1-f]purin-5-one?
The InChIKey is OKVRUQNCBZQIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O/c1-3-6-16-9-15-12-10(16)11-14-5-8-18(11)13(19)17(12)7-4-2/h5,8-9H,3-4,6-7H2,1-2H3.
What are the key properties of 1,4-dipropylimidazo[2,1-f]purin-5-one?
1,4-dipropylimidazo[2,1-f]purin-5-one has a molecular weight of 259.31 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dipropylimidazo[2,1-f]purin-5-one is sourced from PubChem (CID 10706416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).