C14H19NO2S — CID 10706827
(3S)-3-cyclohexyl-3-methyl-2H-1,2-benzothiazole 1,1-dioxide (PubChem CID 10706827) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is (3S)-3-cyclohexyl-3-methyl-2H-1,2-benzothiazole 1,1-dioxide.
| Compound Name | (3S)-3-cyclohexyl-3-methyl-2H-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 10706827 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (3S)-3-cyclohexyl-3-methyl-2H-1,2-benzothiazole 1,1-dioxide |
| SMILES | C[C@@]1(C2CCCCC2)NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H19NO2S/c1-14(11-7-3-2-4-8-11)12-9-5-6-10-13(12)18(16,17)15-14/h5-6,9-11,15H,2-4,7-8H2,1H3/t14-/m0/s1 |
| InChIKey | ADZDJLBNKQLLKI-AWEZNQCLSA-N |
| XLogP | 2.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |