C20H18F3NO5S2 — CID 58806498
[(1'S,3R,10'R)-1,1-dioxospiro[2H-1,2-benzothiazole-3,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl] trifluoromethanesulfonate (PubChem CID 58806498) has the molecular formula C20H18F3NO5S2 and a molecular weight of 473.49 g/mol. Its IUPAC name is [(1'S,3R,10'R)-1,1-dioxospiro[2H-1,2-benzothiazole-3,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl] trifluoromethanesulfonate.
| Compound Name | [(1'S,3R,10'R)-1,1-dioxospiro[2H-1,2-benzothiazole-3,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58806498 |
| Molecular Formula | C20H18F3NO5S2 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | [(1'S,3R,10'R)-1,1-dioxospiro[2H-1,2-benzothiazole-3,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl] trifluoromethanesulfonate |
| SMILES | O=S1(=O)N[C@]2(c3ccccc31)[C@@H]1CC[C@H]2Cc2cc(OS(=O)(=O)C(F)(F)F)ccc2C1 |
| InChI | InChI=1S/C20H18F3NO5S2/c21-20(22,23)31(27,28)29-16-8-5-12-9-14-6-7-15(10-13(12)11-16)19(14)17-3-1-2-4-18(17)30(25,26)24-19/h1-5,8,11,14-15,24H,6-7,9-10H2/t14-,15+,19-/m1/s1 |
| InChIKey | FANIOTVYECCDKM-ZRGWGRIASA-N |
| XLogP | 3.23 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|