C7H8N2O4S — CID 131842760
3-(hydroxyamino)-1,1-dioxo-2H-1,2-benzothiazol-3-ol (PubChem CID 131842760) has the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. Its IUPAC name is 3-(hydroxyamino)-1,1-dioxo-2H-1,2-benzothiazol-3-ol.
| Compound Name | 3-(hydroxyamino)-1,1-dioxo-2H-1,2-benzothiazol-3-ol |
|---|---|
| PubChem CID | 131842760 |
| Molecular Formula | C7H8N2O4S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 3-(hydroxyamino)-1,1-dioxo-2H-1,2-benzothiazol-3-ol |
| SMILES | O=S1(=O)NC(O)(NO)c2ccccc21 |
| InChI | InChI=1S/C7H8N2O4S/c10-7(8-11)5-3-1-2-4-6(5)14(12,13)9-7/h1-4,8-11H |
| InChIKey | STFPTWNAHXLKLB-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|