C21H19NO2S — CID 177415708
(3R)-3-(3,5-dimethylphenyl)-3-phenyl-2H-1,2-benzothiazole 1,1-dioxide (PubChem CID 177415708) has the molecular formula C21H19NO2S and a molecular weight of 349.46 g/mol. Its IUPAC name is (3R)-3-(3,5-dimethylphenyl)-3-phenyl-2H-1,2-benzothiazole 1,1-dioxide.
| Compound Name | (3R)-3-(3,5-dimethylphenyl)-3-phenyl-2H-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 177415708 |
| Molecular Formula | C21H19NO2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (3R)-3-(3,5-dimethylphenyl)-3-phenyl-2H-1,2-benzothiazole 1,1-dioxide |
| SMILES | Cc1cc(C)cc([C@@]2(c3ccccc3)NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C21H19NO2S/c1-15-12-16(2)14-18(13-15)21(17-8-4-3-5-9-17)19-10-6-7-11-20(19)25(23,24)22-21/h3-14,22H,1-2H3/t21-/m1/s1 |
| InChIKey | LDCMFRHGXYOPOE-OAQYLSRUSA-N |
| XLogP | 3.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |