C11H13NO3S — CID 134961236
[(3S)-1,1-dioxo-3-prop-2-enyl-2H-1,2-benzothiazol-3-yl]methanol (PubChem CID 134961236) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is [(3S)-1,1-dioxo-3-prop-2-enyl-2H-1,2-benzothiazol-3-yl]methanol.
| Compound Name | [(3S)-1,1-dioxo-3-prop-2-enyl-2H-1,2-benzothiazol-3-yl]methanol |
|---|---|
| PubChem CID | 134961236 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | [(3S)-1,1-dioxo-3-prop-2-enyl-2H-1,2-benzothiazol-3-yl]methanol |
| SMILES | C=CC[C@]1(CO)NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C11H13NO3S/c1-2-7-11(8-13)9-5-3-4-6-10(9)16(14,15)12-11/h2-6,12-13H,1,7-8H2/t11-/m1/s1 |
| InChIKey | YHURPSIQWMBWDD-LLVKDONJSA-N |
| XLogP | 0.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|