C19H14N2O3S — CID 169007962
2-(15N)nitroso-3,3-diphenyl-1,2-benzothiazole 1,1-dioxide (PubChem CID 169007962) has the molecular formula C19H14N2O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is 2-(15N)nitroso-3,3-diphenyl-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 2-(15N)nitroso-3,3-diphenyl-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 169007962 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-(15N)nitroso-3,3-diphenyl-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=[15N]N1C(c2ccccc2)(c2ccccc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C19H14N2O3S/c22-20-21-19(15-9-3-1-4-10-15,16-11-5-2-6-12-16)17-13-7-8-14-18(17)25(21,23)24/h1-14H/i20+1 |
| InChIKey | FEWGAGURJQKKNQ-UUZXFVOJSA-N |
| XLogP | 3.66 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|