C9H10NNaO3S — CID 10082796
sodium 3-ethyl-1,1-dioxo-1,2-benzothiazol-2-id-3-ol (PubChem CID 10082796) has the molecular formula C9H10NNaO3S and a molecular weight of 235.24 g/mol. Its IUPAC name is sodium 3-ethyl-1,1-dioxo-1,2-benzothiazol-2-id-3-ol.
| Compound Name | sodium 3-ethyl-1,1-dioxo-1,2-benzothiazol-2-id-3-ol |
|---|---|
| PubChem CID | 10082796 |
| Molecular Formula | C9H10NNaO3S |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | sodium 3-ethyl-1,1-dioxo-1,2-benzothiazol-2-id-3-ol |
| SMILES | CCC1(O)[N-]S(=O)(=O)c2ccccc21.[Na+] |
| InChI | InChI=1S/C9H10NO3S.Na/c1-2-9(11)7-5-3-4-6-8(7)14(12,13)10-9;/h3-6,11H,2H2,1H3;/q-1;+1 |
| InChIKey | RJEPJKVTVUANCK-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |