About (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol
(2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol (PubChem CID 46205413) has the molecular formula C16H15ClO3S
and a molecular weight of 322.81 g/mol. Its IUPAC name is (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol.
Molecular Properties
| Compound Name | (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol |
| PubChem CID | 46205413 |
| Molecular Formula | C16H15ClO3S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol |
| SMILES | O=S1(=O)c2ccccc2[C@](O)(c2ccccc2)[C@@H]1CCCl |
| InChI | InChI=1S/C16H15ClO3S/c17-11-10-15-16(18,12-6-2-1-3-7-12)13-8-4-5-9-14(13)21(15,19)20/h1-9,15,18H,10-11H2/t15-,16+/m0/s1 |
| InChIKey | DZKABRWKKMTQBO-JKSUJKDBSA-N |
| XLogP | 2.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol?
The IUPAC name of (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol (CID 46205413) is (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol.
What is the SMILES notation for (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol?
The canonical SMILES for (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol is O=S1(=O)c2ccccc2[C@](O)(c2ccccc2)[C@@H]1CCCl.
What is the InChIKey of (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol?
The InChIKey is DZKABRWKKMTQBO-JKSUJKDBSA-N. The full InChI is InChI=1S/C16H15ClO3S/c17-11-10-15-16(18,12-6-2-1-3-7-12)13-8-4-5-9-14(13)21(15,19)20/h1-9,15,18H,10-11H2/t15-,16+/m0/s1.
What are the key properties of (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol?
(2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol has a molecular weight of 322.81 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-(2-chloroethyl)-1,1-dioxo-3-phenyl-2H-1-benzothiophen-3-ol is sourced from PubChem (CID 46205413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).