C16H15N3O4 — CID 10710294
(3aR,6aR)-3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-5-methyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 10710294) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is (3aR,6aR)-3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-5-methyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aR,6aR)-3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-5-methyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 10710294 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (3aR,6aR)-3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-5-methyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CN1C(=O)[C@@H]2C([C@]3(C)C(=O)N(C)c4ccccc43)=NO[C@H]2C1=O |
| InChI | InChI=1S/C16H15N3O4/c1-16(8-6-4-5-7-9(8)18(2)15(16)22)12-10-11(23-17-12)14(21)19(3)13(10)20/h4-7,10-11H,1-3H3/t10-,11+,16+/m0/s1 |
| InChIKey | JZRCIGUFVJBCJJ-LYOVBCGYSA-N |
| XLogP | 0.29 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|