C24H23NO — CID 157328720
1,3-dimethyl-3-[4-(2-phenylethyl)phenyl]indol-2-one (PubChem CID 157328720) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is 1,3-dimethyl-3-[4-(2-phenylethyl)phenyl]indol-2-one.
| Compound Name | 1,3-dimethyl-3-[4-(2-phenylethyl)phenyl]indol-2-one |
|---|---|
| PubChem CID | 157328720 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1,3-dimethyl-3-[4-(2-phenylethyl)phenyl]indol-2-one |
| SMILES | CN1C(=O)C(C)(c2ccc(CCc3ccccc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H23NO/c1-24(21-10-6-7-11-22(21)25(2)23(24)26)20-16-14-19(15-17-20)13-12-18-8-4-3-5-9-18/h3-11,14-17H,12-13H2,1-2H3 |
| InChIKey | MGCZGMPRPRYZDG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |