C14H16Cl2O4 — CID 10710734
(2R)-2-[(2,6-dichlorophenyl)methoxy]-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 10710734) has the molecular formula C14H16Cl2O4 and a molecular weight of 319.18 g/mol. Its IUPAC name is (2R)-2-[(2,6-dichlorophenyl)methoxy]-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | (2R)-2-[(2,6-dichlorophenyl)methoxy]-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 10710734 |
| Molecular Formula | C14H16Cl2O4 |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | (2R)-2-[(2,6-dichlorophenyl)methoxy]-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | CC1(C)OC[C@H]([C@H](C=O)OCc2c(Cl)cccc2Cl)O1 |
| InChI | InChI=1S/C14H16Cl2O4/c1-14(2)19-8-13(20-14)12(6-17)18-7-9-10(15)4-3-5-11(9)16/h3-6,12-13H,7-8H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | UXOQZZMRPOBDPR-QWHCGFSZSA-N |
| XLogP | 3.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|