C22H21NO6S2 — CID 10718749
methyl 3,3-bis(benzenesulfonyl)-1-cyano-4-ethenylcyclopentane-1-carboxylate (PubChem CID 10718749) has the molecular formula C22H21NO6S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is methyl 3,3-bis(benzenesulfonyl)-1-cyano-4-ethenylcyclopentane-1-carboxylate.
| Compound Name | methyl 3,3-bis(benzenesulfonyl)-1-cyano-4-ethenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10718749 |
| Molecular Formula | C22H21NO6S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | methyl 3,3-bis(benzenesulfonyl)-1-cyano-4-ethenylcyclopentane-1-carboxylate |
| SMILES | C=CC1CC(C#N)(C(=O)OC)CC1(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21NO6S2/c1-3-17-14-21(16-23,20(24)29-2)15-22(17,30(25,26)18-10-6-4-7-11-18)31(27,28)19-12-8-5-9-13-19/h3-13,17H,1,14-15H2,2H3 |
| InChIKey | JNXFDIVOTNEPPM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 118.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|