C23H25Cl2N3O3 — CID 10718872
5-[3-[(2S,4S)-2-(2,4-dichlorophenyl)-4-(phenylmethoxymethyl)-1,3-dioxolan-2-yl]propyl]-1-methyl-1,2,4-triazole (PubChem CID 10718872) has the molecular formula C23H25Cl2N3O3 and a molecular weight of 462.38 g/mol. Its IUPAC name is 5-[3-[(2S,4S)-2-(2,4-dichlorophenyl)-4-(phenylmethoxymethyl)-1,3-dioxolan-2-yl]propyl]-1-methyl-1,2,4-triazole.
| Compound Name | 5-[3-[(2S,4S)-2-(2,4-dichlorophenyl)-4-(phenylmethoxymethyl)-1,3-dioxolan-2-yl]propyl]-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 10718872 |
| Molecular Formula | C23H25Cl2N3O3 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 5-[3-[(2S,4S)-2-(2,4-dichlorophenyl)-4-(phenylmethoxymethyl)-1,3-dioxolan-2-yl]propyl]-1-methyl-1,2,4-triazole |
| SMILES | Cn1ncnc1CCC[C@]1(c2ccc(Cl)cc2Cl)OC[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C23H25Cl2N3O3/c1-28-22(26-16-27-28)8-5-11-23(20-10-9-18(24)12-21(20)25)30-15-19(31-23)14-29-13-17-6-3-2-4-7-17/h2-4,6-7,9-10,12,16,19H,5,8,11,13-15H2,1H3/t19-,23-/m0/s1 |
| InChIKey | DANRNJFEMXEFBD-CVDCTZTESA-N |
| XLogP | 4.93 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |