C9H15ClF3NO — CID 107205621
N-(5-chloropentyl)-3,3,3-trifluoro-N-methylpropanamide (PubChem CID 107205621) has the molecular formula C9H15ClF3NO and a molecular weight of 245.67 g/mol. Its IUPAC name is N-(5-chloropentyl)-3,3,3-trifluoro-N-methylpropanamide.
| Compound Name | N-(5-chloropentyl)-3,3,3-trifluoro-N-methylpropanamide |
|---|---|
| PubChem CID | 107205621 |
| Molecular Formula | C9H15ClF3NO |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-(5-chloropentyl)-3,3,3-trifluoro-N-methylpropanamide |
| SMILES | CN(CCCCCCl)C(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H15ClF3NO/c1-14(6-4-2-3-5-10)8(15)7-9(11,12)13/h2-7H2,1H3 |
| InChIKey | VJZXVERJTKQQBO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|