C39H42N8O4 — CID 10723277
1,4,14,22,32,35,38,41-octazanonacyclo[39.2.2.235,38.02,6.07,15.08,13.021,29.023,28.030,34]heptatetraconta-2(6),7(15),8,10,12,21(29),23,25,27,30(34)-decaene-3,5,31,33-tetrone (PubChem CID 10723277) has the molecular formula C39H42N8O4 and a molecular weight of 686.82 g/mol. Its IUPAC name is 1,4,14,22,32,35,38,41-octazanonacyclo[39.2.2.235,38.02,6.07,15.08,13.021,29.023,28.030,34]heptatetraconta-2(6),7(15),8,10,12,21(29),23,25,27,30(34)-decaene-3,5,31,33-tetrone.
| Compound Name | 1,4,14,22,32,35,38,41-octazanonacyclo[39.2.2.235,38.02,6.07,15.08,13.021,29.023,28.030,34]heptatetraconta-2(6),7(15),8,10,12,21(29),23,25,27,30(34)-decaene-3,5,31,33-tetrone |
|---|---|
| PubChem CID | 10723277 |
| Molecular Formula | C39H42N8O4 |
| Molecular Weight | 686.82 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | 1,4,14,22,32,35,38,41-octazanonacyclo[39.2.2.235,38.02,6.07,15.08,13.021,29.023,28.030,34]heptatetraconta-2(6),7(15),8,10,12,21(29),23,25,27,30(34)-decaene-3,5,31,33-tetrone |
| SMILES | O=C1NC(=O)C2=C1c1c([nH]c3ccccc13)CCCCCc1[nH]c3ccccc3c1C1=C(C(=O)NC1=O)N1CCN(CCN3CCN2CC3)CC1 |
| InChI | InChI=1S/C39H42N8O4/c48-36-32-30-24-8-4-6-10-26(24)40-28(30)12-2-1-3-13-29-31(25-9-5-7-11-27(25)41-29)33-35(39(51)43-37(33)49)47-22-18-45(19-23-47)15-14-44-16-20-46(21-17-44)34(32)38(50)42-36/h4-11,40-41H,1-3,12-23H2,(H,42,48,50)(H,43,49,51) |
| InChIKey | YJPRXAJDNXAKBL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 136.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.82 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|