C13H17BrF3NO — CID 107289936
3-[[5-bromo-2-(trifluoromethyl)phenoxy]methyl]pentan-3-amine (PubChem CID 107289936) has the molecular formula C13H17BrF3NO and a molecular weight of 340.18 g/mol. Its IUPAC name is 3-[[5-bromo-2-(trifluoromethyl)phenoxy]methyl]pentan-3-amine.
| Compound Name | 3-[[5-bromo-2-(trifluoromethyl)phenoxy]methyl]pentan-3-amine |
|---|---|
| PubChem CID | 107289936 |
| Molecular Formula | C13H17BrF3NO |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-[[5-bromo-2-(trifluoromethyl)phenoxy]methyl]pentan-3-amine |
| SMILES | CCC(N)(CC)COc1cc(Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C13H17BrF3NO/c1-3-12(18,4-2)8-19-11-7-9(14)5-6-10(11)13(15,16)17/h5-7H,3-4,8,18H2,1-2H3 |
| InChIKey | ZDPAUFPUGGMHKB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |