C17H23NO3SSi — CID 10736556
2-(4-methylphenyl)sulfonyl-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-5-one (PubChem CID 10736556) has the molecular formula C17H23NO3SSi and a molecular weight of 349.53 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-5-one.
| Compound Name | 2-(4-methylphenyl)sulfonyl-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-5-one |
|---|---|
| PubChem CID | 10736556 |
| Molecular Formula | C17H23NO3SSi |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C([Si](C)(C)C)C(=O)CC3C2)cc1 |
| InChI | InChI=1S/C17H23NO3SSi/c1-12-5-7-14(8-6-12)22(20,21)18-10-13-9-16(19)17(15(13)11-18)23(2,3)4/h5-8,13H,9-11H2,1-4H3 |
| InChIKey | SEBWAUCWPFZUIY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|