C12H8N4O2S — CID 107372297
5-(1,3-benzothiazol-2-ylamino)pyrazine-2-carboxylic acid (PubChem CID 107372297) has the molecular formula C12H8N4O2S and a molecular weight of 272.29 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylamino)pyrazine-2-carboxylic acid.
| Compound Name | 5-(1,3-benzothiazol-2-ylamino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107372297 |
| Molecular Formula | C12H8N4O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylamino)pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(Nc2nc3ccccc3s2)cn1 |
| InChI | InChI=1S/C12H8N4O2S/c17-11(18)8-5-14-10(6-13-8)16-12-15-7-3-1-2-4-9(7)19-12/h1-6H,(H,17,18)(H,14,15,16) |
| InChIKey | LZBYYJXGJRHLDA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |