C29H38O5Si — CID 10743810
methyl (3aR,7S,7aR)-7-[tert-butyl(diphenyl)silyl]oxy-2,2-diethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 10743810) has the molecular formula C29H38O5Si and a molecular weight of 494.70 g/mol. Its IUPAC name is methyl (3aR,7S,7aR)-7-[tert-butyl(diphenyl)silyl]oxy-2,2-diethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aR,7S,7aR)-7-[tert-butyl(diphenyl)silyl]oxy-2,2-diethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 10743810 |
| Molecular Formula | C29H38O5Si |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | methyl (3aR,7S,7aR)-7-[tert-butyl(diphenyl)silyl]oxy-2,2-diethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | CCC1(CC)O[C@H]2[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C=C(C(=O)OC)C[C@H]2O1 |
| InChI | InChI=1S/C29H38O5Si/c1-7-29(8-2)32-24-19-21(27(30)31-6)20-25(26(24)33-29)34-35(28(3,4)5,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,20,24-26H,7-8,19H2,1-6H3/t24-,25+,26-/m1/s1 |
| InChIKey | KETNDPTVPHJMBT-UODIDJSMSA-N |
| XLogP | 4.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|