C30H42O7 — CID 10744400
(1S,2R,4S,5S,6Z,8R)-2,8-dihydroxy-5-[(4S)-4-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,11,11-trimethylbicyclo[6.2.1]undec-6-en-3-one (PubChem CID 10744400) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is (1S,2R,4S,5S,6Z,8R)-2,8-dihydroxy-5-[(4S)-4-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,11,11-trimethylbicyclo[6.2.1]undec-6-en-3-one.
| Compound Name | (1S,2R,4S,5S,6Z,8R)-2,8-dihydroxy-5-[(4S)-4-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,11,11-trimethylbicyclo[6.2.1]undec-6-en-3-one |
|---|---|
| PubChem CID | 10744400 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | (1S,2R,4S,5S,6Z,8R)-2,8-dihydroxy-5-[(4S)-4-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,11,11-trimethylbicyclo[6.2.1]undec-6-en-3-one |
| SMILES | C=C[C@@H](OCc1ccc(OC)cc1)[C@]1([C@H]2/C=C\[C@]3(O)CC[C@H]([C@@H](O)C(=O)[C@H]2C)C3(C)C)COC(C)(C)O1 |
| InChI | InChI=1S/C30H42O7/c1-8-24(35-17-20-9-11-21(34-7)12-10-20)30(18-36-28(5,6)37-30)22-13-15-29(33)16-14-23(27(29,3)4)26(32)25(31)19(22)2/h8-13,15,19,22-24,26,32-33H,1,14,16-18H2,2-7H3/b15-13-/t19-,22-,23+,24+,26+,29-,30+/m0/s1 |
| InChIKey | CAGHKDROIIZUMR-DRZMJQEMSA-N |
| XLogP | 4.21 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|