C26H35IO8 — CID 24873752
(2S)-2-[(1R,4R,5S)-4-[(E,1S,2S)-4-iodo-2-methoxy-1-(methoxymethoxy)pent-3-enyl]-7,7-dimethyl-3-oxo-2-oxabicyclo[3.2.0]heptan-1-yl]-2-[(4-methoxyphenyl)methoxy]acetaldehyde (PubChem CID 24873752) has the molecular formula C26H35IO8 and a molecular weight of 602.46 g/mol. Its IUPAC name is (2S)-2-[(1R,4R,5S)-4-[(E,1S,2S)-4-iodo-2-methoxy-1-(methoxymethoxy)pent-3-enyl]-7,7-dimethyl-3-oxo-2-oxabicyclo[3.2.0]heptan-1-yl]-2-[(4-methoxyphenyl)methoxy]acetaldehyde.
| Compound Name | (2S)-2-[(1R,4R,5S)-4-[(E,1S,2S)-4-iodo-2-methoxy-1-(methoxymethoxy)pent-3-enyl]-7,7-dimethyl-3-oxo-2-oxabicyclo[3.2.0]heptan-1-yl]-2-[(4-methoxyphenyl)methoxy]acetaldehyde |
|---|---|
| PubChem CID | 24873752 |
| Molecular Formula | C26H35IO8 |
| Molecular Weight | 602.46 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | (2S)-2-[(1R,4R,5S)-4-[(E,1S,2S)-4-iodo-2-methoxy-1-(methoxymethoxy)pent-3-enyl]-7,7-dimethyl-3-oxo-2-oxabicyclo[3.2.0]heptan-1-yl]-2-[(4-methoxyphenyl)methoxy]acetaldehyde |
| SMILES | COCO[C@@H]([C@@H]1C(=O)O[C@]2([C@@H](C=O)OCc3ccc(OC)cc3)[C@H]1CC2(C)C)[C@H](/C=C(\C)I)OC |
| InChI | InChI=1S/C26H35IO8/c1-16(27)11-20(32-6)23(34-15-30-4)22-19-12-25(2,3)26(19,35-24(22)29)21(13-28)33-14-17-7-9-18(31-5)10-8-17/h7-11,13,19-23H,12,14-15H2,1-6H3/b16-11+/t19-,20-,21+,22+,23+,26-/m0/s1 |
| InChIKey | JUMFEZMTSZZEGK-OTUSYRKRSA-N |
| XLogP | 4.08 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|