C24H38O9 — CID 11751763
(2R,3R,5S,7R,8R)-3,7-dimethoxy-2,8-bis(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]dec-9-enal (PubChem CID 11751763) has the molecular formula C24H38O9 and a molecular weight of 470.56 g/mol. Its IUPAC name is (2R,3R,5S,7R,8R)-3,7-dimethoxy-2,8-bis(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]dec-9-enal.
| Compound Name | (2R,3R,5S,7R,8R)-3,7-dimethoxy-2,8-bis(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]dec-9-enal |
|---|---|
| PubChem CID | 11751763 |
| Molecular Formula | C24H38O9 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (2R,3R,5S,7R,8R)-3,7-dimethoxy-2,8-bis(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]dec-9-enal |
| SMILES | C=C[C@@H](OCOC)[C@@H](C[C@@H](C[C@@H](OC)[C@H](C=O)OCOC)OCc1ccc(OC)cc1)OC |
| InChI | InChI=1S/C24H38O9/c1-7-21(32-16-26-2)22(29-5)12-20(13-23(30-6)24(14-25)33-17-27-3)31-15-18-8-10-19(28-4)11-9-18/h7-11,14,20-24H,1,12-13,15-17H2,2-6H3/t20-,21+,22+,23+,24-/m0/s1 |
| InChIKey | FHLHKPMMHXCVTE-LSDVVMKASA-N |
| XLogP | 2.75 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|