C18H23IO4 — CID 10836372
(4S)-4-[(Z)-2-iodoethenyl]-4-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10836372) has the molecular formula C18H23IO4 and a molecular weight of 430.28 g/mol. Its IUPAC name is (4S)-4-[(Z)-2-iodoethenyl]-4-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(Z)-2-iodoethenyl]-4-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10836372 |
| Molecular Formula | C18H23IO4 |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | (4S)-4-[(Z)-2-iodoethenyl]-4-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=C[C@@H](OCc1ccc(OC)cc1)[C@]1(/C=C\I)COC(C)(C)O1 |
| InChI | InChI=1S/C18H23IO4/c1-5-16(18(10-11-19)13-22-17(2,3)23-18)21-12-14-6-8-15(20-4)9-7-14/h5-11,16H,1,12-13H2,2-4H3/b11-10-/t16-,18+/m1/s1 |
| InChIKey | QBTXQAPHNNGNGP-PJDFAFLYSA-N |
| XLogP | 4.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|