C24H40N2O4 — CID 10574444
N-[(E)-[(3S,4R,5R)-6-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhexan-2-ylidene]amino]-N-methylmethanamine (PubChem CID 10574444) has the molecular formula C24H40N2O4 and a molecular weight of 420.59 g/mol. Its IUPAC name is N-[(E)-[(3S,4R,5R)-6-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhexan-2-ylidene]amino]-N-methylmethanamine.
| Compound Name | N-[(E)-[(3S,4R,5R)-6-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhexan-2-ylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 10574444 |
| Molecular Formula | C24H40N2O4 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | N-[(E)-[(3S,4R,5R)-6-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhexan-2-ylidene]amino]-N-methylmethanamine |
| SMILES | COc1ccc(CO[C@H]([C@H](C)CC2OCC(C)(C)CO2)[C@@H](C)/C(C)=N/N(C)C)cc1 |
| InChI | InChI=1S/C24H40N2O4/c1-17(13-22-29-15-24(4,5)16-30-22)23(18(2)19(3)25-26(6)7)28-14-20-9-11-21(27-8)12-10-20/h9-12,17-18,22-23H,13-16H2,1-8H3/b25-19+/t17-,18+,23-/m1/s1 |
| InChIKey | UWZRCDLVGUJMCD-GDYSORKVSA-N |
| XLogP | 4.58 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|