About CID 10746234
CID 10746234 (PubChem CID 10746234) has the molecular formula C25H44O2SSeSn
and a molecular weight of 606.36 g/mol.
Molecular Properties
| Compound Name | CID 10746234 |
| PubChem CID | 10746234 |
| Molecular Formula | C25H44O2SSeSn |
| Molecular Weight | 606.36 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | — |
| SMILES | CC(CCCC[Se])OC(=S)Oc1ccccc1.CCCC[Sn](CCCC)CCCC |
| InChI | InChI=1S/C13H17O2SSe.3C4H9.Sn/c1-11(7-5-6-10-17)14-13(16)15-12-8-3-2-4-9-12;3*1-3-4-2;/h2-4,8-9,11H,5-7,10H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | YWWNNGSOGVXOKD-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 606.36 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 10746234 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10746234?
The IUPAC name of CID 10746234 (CID 10746234) is not available.
What is the SMILES notation for CID 10746234?
The canonical SMILES for CID 10746234 is CC(CCCC[Se])OC(=S)Oc1ccccc1.CCCC[Sn](CCCC)CCCC.
What is the InChIKey of CID 10746234?
The InChIKey is YWWNNGSOGVXOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17O2SSe.3C4H9.Sn/c1-11(7-5-6-10-17)14-13(16)15-12-8-3-2-4-9-12;3*1-3-4-2;/h2-4,8-9,11H,5-7,10H2,1H3;3*1,3-4H2,2H3;.
What are the key properties of CID 10746234?
CID 10746234 has a molecular weight of 606.36 g/mol, XLogP of 8.39, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10746234 is sourced from PubChem (CID 10746234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).