C7H10ClF2N3O2S — CID 107492898
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 107492898) has the molecular formula C7H10ClF2N3O2S and a molecular weight of 273.69 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 107492898 |
| Molecular Formula | C7H10ClF2N3O2S |
| Molecular Weight | 273.69 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(c1ccn[nH]1)N(CCCl)CC(F)F |
| InChI | InChI=1S/C7H10ClF2N3O2S/c8-2-4-13(5-6(9)10)16(14,15)7-1-3-11-12-7/h1,3,6H,2,4-5H2,(H,11,12) |
| InChIKey | GSVWVULKVAFSOH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.69 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|