C15H16F2N2 — CID 107514567
6-(2,3-difluoro-4-methylphenyl)-N-propylpyridin-2-amine (PubChem CID 107514567) has the molecular formula C15H16F2N2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 6-(2,3-difluoro-4-methylphenyl)-N-propylpyridin-2-amine.
| Compound Name | 6-(2,3-difluoro-4-methylphenyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 107514567 |
| Molecular Formula | C15H16F2N2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 6-(2,3-difluoro-4-methylphenyl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1cccc(-c2ccc(C)c(F)c2F)n1 |
| InChI | InChI=1S/C15H16F2N2/c1-3-9-18-13-6-4-5-12(19-13)11-8-7-10(2)14(16)15(11)17/h4-8H,3,9H2,1-2H3,(H,18,19) |
| InChIKey | HVEOVRFXMAYSTN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |