C15H27LiSi — CID 10752708
lithium [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane (PubChem CID 10752708) has the molecular formula C15H27LiSi and a molecular weight of 242.41 g/mol. Its IUPAC name is lithium [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane.
| Compound Name | lithium [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10752708 |
| Molecular Formula | C15H27LiSi |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | lithium [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane |
| SMILES | CC(C)=CCC[C@@H](C)C[CH-]C#C[Si](C)(C)C.[Li+] |
| InChI | InChI=1S/C15H27Si.Li/c1-14(2)10-9-12-15(3)11-7-8-13-16(4,5)6;/h7,10,15H,9,11-12H2,1-6H3;/q-1;+1/t15-;/m0./s1 |
| InChIKey | RNROASDKVZIAIB-RSAXXLAASA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|