C13H13Cl2FN2O3 — CID 107576438
3-cyclopropyl-3-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]propanoic acid (PubChem CID 107576438) has the molecular formula C13H13Cl2FN2O3 and a molecular weight of 335.16 g/mol. Its IUPAC name is 3-cyclopropyl-3-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 107576438 |
| Molecular Formula | C13H13Cl2FN2O3 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-cyclopropyl-3-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)Nc1cc(Cl)c(F)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C13H13Cl2FN2O3/c14-8-3-7(4-9(15)12(8)16)17-13(21)18-10(5-11(19)20)6-1-2-6/h3-4,6,10H,1-2,5H2,(H,19,20)(H2,17,18,21) |
| InChIKey | VXEICPDPCPKJJO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|