C16H20BrNO4 — CID 10761646
methyl (2S)-4-bromo-2-[(1S)-1-methoxy-3-oxo-1H-isoindol-2-yl]-4-methylpentanoate (PubChem CID 10761646) has the molecular formula C16H20BrNO4 and a molecular weight of 370.24 g/mol. Its IUPAC name is methyl (2S)-4-bromo-2-[(1S)-1-methoxy-3-oxo-1H-isoindol-2-yl]-4-methylpentanoate.
| Compound Name | methyl (2S)-4-bromo-2-[(1S)-1-methoxy-3-oxo-1H-isoindol-2-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 10761646 |
| Molecular Formula | C16H20BrNO4 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | methyl (2S)-4-bromo-2-[(1S)-1-methoxy-3-oxo-1H-isoindol-2-yl]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)(C)Br)N1C(=O)c2ccccc2[C@@H]1OC |
| InChI | InChI=1S/C16H20BrNO4/c1-16(2,17)9-12(15(20)22-4)18-13(19)10-7-5-6-8-11(10)14(18)21-3/h5-8,12,14H,9H2,1-4H3/t12-,14-/m0/s1 |
| InChIKey | IBIWFEGOYBJZIF-JSGCOSHPSA-N |
| XLogP | 2.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|