C16H34N8O6 — CID 10765272
(2S)-2-amino-N-[(2S,3R,4R,5S,6R)-6-(aminomethyl)-2-[2-[(2-amino-2-oxoethyl)amino]ethoxy]-4,5-dihydroxyoxan-3-yl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 10765272) has the molecular formula C16H34N8O6 and a molecular weight of 434.50 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S,3R,4R,5S,6R)-6-(aminomethyl)-2-[2-[(2-amino-2-oxoethyl)amino]ethoxy]-4,5-dihydroxyoxan-3-yl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-amino-N-[(2S,3R,4R,5S,6R)-6-(aminomethyl)-2-[2-[(2-amino-2-oxoethyl)amino]ethoxy]-4,5-dihydroxyoxan-3-yl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 10765272 |
| Molecular Formula | C16H34N8O6 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | (2S)-2-amino-N-[(2S,3R,4R,5S,6R)-6-(aminomethyl)-2-[2-[(2-amino-2-oxoethyl)amino]ethoxy]-4,5-dihydroxyoxan-3-yl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC[C@H]1O[C@H](OCCNCC(N)=O)[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H34N8O6/c17-6-9-12(26)13(27)11(15(30-9)29-5-4-22-7-10(19)25)24-14(28)8(18)2-1-3-23-16(20)21/h8-9,11-13,15,22,26-27H,1-7,17-18H2,(H2,19,25)(H,24,28)(H4,20,21,23)/t8-,9+,11+,12+,13+,15-/m0/s1 |
| InChIKey | LECYXRWMEZURRC-BTIXGSHYSA-N |
| XLogP | -5.65 |
| TPSA | 259.58 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|