C12H24BN5O5 — CID 163884137
2-[3-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-2-hydroxyoxaborinan-6-yl]acetic acid (PubChem CID 163884137) has the molecular formula C12H24BN5O5 and a molecular weight of 329.17 g/mol. Its IUPAC name is 2-[3-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-2-hydroxyoxaborinan-6-yl]acetic acid.
| Compound Name | 2-[3-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-2-hydroxyoxaborinan-6-yl]acetic acid |
|---|---|
| PubChem CID | 163884137 |
| Molecular Formula | C12H24BN5O5 |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-[3-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-2-hydroxyoxaborinan-6-yl]acetic acid |
| SMILES | NC(N)=NCCC[C@@H](N)C(=O)NC1CCC(CC(=O)O)OB1O |
| InChI | InChI=1S/C12H24BN5O5/c14-8(2-1-5-17-12(15)16)11(21)18-9-4-3-7(6-10(19)20)23-13(9)22/h7-9,22H,1-6,14H2,(H,18,21)(H,19,20)(H4,15,16,17)/t7?,8-,9?/m1/s1 |
| InChIKey | PVWCTBIGPMGDHO-QJAFJHJLSA-N |
| XLogP | -2.47 |
| TPSA | 186.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|