C12H13ClN4O2 — CID 107681627
N-(3-chloro-4-hydroxyphenyl)-5-propyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 107681627) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.71 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-5-propyl-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-5-propyl-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 107681627 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-5-propyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCCc1nc(C(=O)Nc2ccc(O)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-2-3-10-15-11(17-16-10)12(19)14-7-4-5-9(18)8(13)6-7/h4-6,18H,2-3H2,1H3,(H,14,19)(H,15,16,17) |
| InChIKey | QDLGRUOAKXQQDT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|