C16H12BrFO2 — CID 107684074
5-[(2-bromo-3-fluorophenyl)methoxy]-2,3-dihydroinden-1-one (PubChem CID 107684074) has the molecular formula C16H12BrFO2 and a molecular weight of 335.17 g/mol. Its IUPAC name is 5-[(2-bromo-3-fluorophenyl)methoxy]-2,3-dihydroinden-1-one.
| Compound Name | 5-[(2-bromo-3-fluorophenyl)methoxy]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 107684074 |
| Molecular Formula | C16H12BrFO2 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 5-[(2-bromo-3-fluorophenyl)methoxy]-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(OCc3cccc(F)c3Br)ccc21 |
| InChI | InChI=1S/C16H12BrFO2/c17-16-11(2-1-3-14(16)18)9-20-12-5-6-13-10(8-12)4-7-15(13)19/h1-3,5-6,8H,4,7,9H2 |
| InChIKey | HHABVOXYDUGOQD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |