C35H31N2OP — CID 10768454
N-[(E)-[(7Z)-9-diphenylphosphorylundeca-7,9,10-trien-5-ynylidene]amino]-N-phenylaniline (PubChem CID 10768454) has the molecular formula C35H31N2OP and a molecular weight of 526.62 g/mol. Its IUPAC name is N-[(E)-[(7Z)-9-diphenylphosphorylundeca-7,9,10-trien-5-ynylidene]amino]-N-phenylaniline.
| Compound Name | N-[(E)-[(7Z)-9-diphenylphosphorylundeca-7,9,10-trien-5-ynylidene]amino]-N-phenylaniline |
|---|---|
| PubChem CID | 10768454 |
| Molecular Formula | C35H31N2OP |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | N-[(E)-[(7Z)-9-diphenylphosphorylundeca-7,9,10-trien-5-ynylidene]amino]-N-phenylaniline |
| SMILES | C=C=C(/C=C\C#CCCC/C=N/N(c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H31N2OP/c1-2-33(39(38,34-26-16-9-17-27-34)35-28-18-10-19-29-35)25-15-5-3-4-6-20-30-36-37(31-21-11-7-12-22-31)32-23-13-8-14-24-32/h7-19,21-30H,1,4,6,20H2/b25-15-,36-30+ |
| InChIKey | WZIGWLLRJZUFBU-YRDOVQBFSA-N |
| XLogP | 8.22 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|